C17H25NO — CID 174150594
(3R)-3-[(3E,6Z,9E)-3-methyl-2-methylidene-1-azacycloundeca-3,6,9-trien-1-yl]pent-1-en-2-ol (PubChem CID 174150594) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is (3R)-3-[(3E,6Z,9E)-3-methyl-2-methylidene-1-azacycloundeca-3,6,9-trien-1-yl]pent-1-en-2-ol.
| Compound Name | (3R)-3-[(3E,6Z,9E)-3-methyl-2-methylidene-1-azacycloundeca-3,6,9-trien-1-yl]pent-1-en-2-ol |
|---|---|
| PubChem CID | 174150594 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | (3R)-3-[(3E,6Z,9E)-3-methyl-2-methylidene-1-azacycloundeca-3,6,9-trien-1-yl]pent-1-en-2-ol |
| SMILES | C=C(O)[C@@H](CC)N1C/C=C/C/C=C\C/C=C(\C)C1=C |
| InChI | InChI=1S/C17H25NO/c1-5-17(16(4)19)18-13-11-9-7-6-8-10-12-14(2)15(18)3/h6,8-9,11-12,17,19H,3-5,7,10,13H2,1-2H3/b8-6-,11-9+,14-12+/t17-/m1/s1 |
| InChIKey | OUWDWTWASFFJOI-CLIISZFVSA-N |
| XLogP | 4.50 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|