C25H3BF20N6 — CID 174150712
[3-(1,1-difluoroethyl)-4,5,6,7-tetrafluoroindazol-1-yl]-bis[4,5,6,7-tetrafluoro-3-(trifluoromethyl)indazol-1-yl]borane (PubChem CID 174150712) has the molecular formula C25H3BF20N6 and a molecular weight of 778.11 g/mol. Its IUPAC name is [3-(1,1-difluoroethyl)-4,5,6,7-tetrafluoroindazol-1-yl]-bis[4,5,6,7-tetrafluoro-3-(trifluoromethyl)indazol-1-yl]borane.
| Compound Name | [3-(1,1-difluoroethyl)-4,5,6,7-tetrafluoroindazol-1-yl]-bis[4,5,6,7-tetrafluoro-3-(trifluoromethyl)indazol-1-yl]borane |
|---|---|
| PubChem CID | 174150712 |
| Molecular Formula | C25H3BF20N6 |
| Molecular Weight | 778.11 g/mol |
| Exact Mass | 778.02 |
| IUPAC Name | [3-(1,1-difluoroethyl)-4,5,6,7-tetrafluoroindazol-1-yl]-bis[4,5,6,7-tetrafluoro-3-(trifluoromethyl)indazol-1-yl]borane |
| SMILES | CC(F)(F)c1nn(B(n2nc(C(F)(F)F)c3c(F)c(F)c(F)c(F)c32)n2nc(C(F)(F)F)c3c(F)c(F)c(F)c(F)c32)c2c(F)c(F)c(F)c(F)c12 |
| InChI | InChI=1S/C25H3BF20N6/c1-23(39,40)20-2-5(27)8(30)11(33)14(36)17(2)50(47-20)26(51-18-3(21(48-51)24(41,42)43)6(28)9(31)12(34)15(18)37)52-19-4(22(49-52)25(44,45)46)7(29)10(32)13(35)16(19)38/h1H3 |
| InChIKey | GHHYBJPVVLPOCP-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.11 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|