C24H3BF18N6 — CID 174150713
(4,5,6,7-tetrafluoro-3-methylindazol-1-yl)-bis[4,5,6,7-tetrafluoro-3-(trifluoromethyl)indazol-1-yl]borane (PubChem CID 174150713) has the molecular formula C24H3BF18N6 and a molecular weight of 728.11 g/mol. Its IUPAC name is (4,5,6,7-tetrafluoro-3-methylindazol-1-yl)-bis[4,5,6,7-tetrafluoro-3-(trifluoromethyl)indazol-1-yl]borane.
| Compound Name | (4,5,6,7-tetrafluoro-3-methylindazol-1-yl)-bis[4,5,6,7-tetrafluoro-3-(trifluoromethyl)indazol-1-yl]borane |
|---|---|
| PubChem CID | 174150713 |
| Molecular Formula | C24H3BF18N6 |
| Molecular Weight | 728.11 g/mol |
| Exact Mass | 728.02 |
| IUPAC Name | (4,5,6,7-tetrafluoro-3-methylindazol-1-yl)-bis[4,5,6,7-tetrafluoro-3-(trifluoromethyl)indazol-1-yl]borane |
| SMILES | Cc1nn(B(n2nc(C(F)(F)F)c3c(F)c(F)c(F)c(F)c32)n2nc(C(F)(F)F)c3c(F)c(F)c(F)c(F)c32)c2c(F)c(F)c(F)c(F)c12 |
| InChI | InChI=1S/C24H3BF18N6/c1-2-3-6(26)9(29)12(32)15(35)18(3)47(44-2)25(48-19-4(21(45-48)23(38,39)40)7(27)10(30)13(33)16(19)36)49-20-5(22(46-49)24(41,42)43)8(28)11(31)14(34)17(20)37/h1H3 |
| InChIKey | XWJNBZOSYIAGQF-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.11 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|