C52H43NSi — CID 174150949
N-[4-[2-ethenyl-1-phenyl-3-[(Z)-prop-1-enyl]inden-1-yl]phenyl]-5,5-dimethyl-N-(4-phenylphenyl)benzo[b][1]benzosilol-2-amine (PubChem CID 174150949) has the molecular formula C52H43NSi and a molecular weight of 710.01 g/mol. Its IUPAC name is N-[4-[2-ethenyl-1-phenyl-3-[(Z)-prop-1-enyl]inden-1-yl]phenyl]-5,5-dimethyl-N-(4-phenylphenyl)benzo[b][1]benzosilol-2-amine.
| Compound Name | N-[4-[2-ethenyl-1-phenyl-3-[(Z)-prop-1-enyl]inden-1-yl]phenyl]-5,5-dimethyl-N-(4-phenylphenyl)benzo[b][1]benzosilol-2-amine |
|---|---|
| PubChem CID | 174150949 |
| Molecular Formula | C52H43NSi |
| Molecular Weight | 710.01 g/mol |
| Exact Mass | 709.32 |
| IUPAC Name | N-[4-[2-ethenyl-1-phenyl-3-[(Z)-prop-1-enyl]inden-1-yl]phenyl]-5,5-dimethyl-N-(4-phenylphenyl)benzo[b][1]benzosilol-2-amine |
| SMILES | C=CC1=C(/C=C\C)c2ccccc2C1(c1ccccc1)c1ccc(N(c2ccc(-c3ccccc3)cc2)c2ccc3c(c2)-c2ccccc2[Si]3(C)C)cc1 |
| InChI | InChI=1S/C52H43NSi/c1-5-17-44-45-22-13-15-24-49(45)52(48(44)6-2,39-20-11-8-12-21-39)40-28-32-42(33-29-40)53(41-30-26-38(27-31-41)37-18-9-7-10-19-37)43-34-35-51-47(36-43)46-23-14-16-25-50(46)54(51,3)4/h5-36H,2H2,1,3-4H3/b17-5- |
| InChIKey | IJJGHUJAFSGUFZ-ZWSORDCHSA-N |
| XLogP | 12.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.01 |
| LogP ≤ 5 | 12.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|