C17H27ClF3N3O3Si — CID 174151089
4-amino-1-[(2R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(chloromethyl)oxolan-2-yl]-5-(trifluoromethyl)pyrimidin-2-one (PubChem CID 174151089) has the molecular formula C17H27ClF3N3O3Si and a molecular weight of 441.95 g/mol. Its IUPAC name is 4-amino-1-[(2R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(chloromethyl)oxolan-2-yl]-5-(trifluoromethyl)pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(chloromethyl)oxolan-2-yl]-5-(trifluoromethyl)pyrimidin-2-one |
|---|---|
| PubChem CID | 174151089 |
| Molecular Formula | C17H27ClF3N3O3Si |
| Molecular Weight | 441.95 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 4-amino-1-[(2R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(chloromethyl)oxolan-2-yl]-5-(trifluoromethyl)pyrimidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@]1(CCl)CC[C@H](n2cc(C(F)(F)F)c(N)nc2=O)O1 |
| InChI | InChI=1S/C17H27ClF3N3O3Si/c1-15(2,3)28(4,5)26-10-16(9-18)7-6-12(27-16)24-8-11(17(19,20)21)13(22)23-14(24)25/h8,12H,6-7,9-10H2,1-5H3,(H2,22,23,25)/t12-,16-/m1/s1 |
| InChIKey | OUBSGVARVILVRB-MLGOLLRUSA-N |
| XLogP | 4.15 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.95 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|