C24H36N4 — CID 174151233
(Z)-N-cyclohepta-1,6-dien-1-yl-3-[[(2Z,5E,7Z)-5-[2-(ethylamino)ethyl]nona-2,5,7-trienylidene]amino]-N'-methylprop-2-enimidamide (PubChem CID 174151233) has the molecular formula C24H36N4 and a molecular weight of 380.58 g/mol. Its IUPAC name is (Z)-N-cyclohepta-1,6-dien-1-yl-3-[[(2Z,5E,7Z)-5-[2-(ethylamino)ethyl]nona-2,5,7-trienylidene]amino]-N'-methylprop-2-enimidamide.
| Compound Name | (Z)-N-cyclohepta-1,6-dien-1-yl-3-[[(2Z,5E,7Z)-5-[2-(ethylamino)ethyl]nona-2,5,7-trienylidene]amino]-N'-methylprop-2-enimidamide |
|---|---|
| PubChem CID | 174151233 |
| Molecular Formula | C24H36N4 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | (Z)-N-cyclohepta-1,6-dien-1-yl-3-[[(2Z,5E,7Z)-5-[2-(ethylamino)ethyl]nona-2,5,7-trienylidene]amino]-N'-methylprop-2-enimidamide |
| SMILES | C/C=C\C=C(/C/C=C\C=N\C=C/C(=N\C)NC1=CCCCC=C1)CCNCC |
| InChI | InChI=1S/C24H36N4/c1-4-6-13-22(17-20-26-5-2)14-11-12-19-27-21-18-24(25-3)28-23-15-9-7-8-10-16-23/h4,6,9,11-13,15-16,18-19,21,26H,5,7-8,10,14,17,20H2,1-3H3,(H,25,28)/b6-4-,12-11-,21-18-,22-13+,27-19+ |
| InChIKey | FGYJCGDHWKVFAT-LUCHTABQSA-N |
| XLogP | 5.26 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|