C18H21N5O3 — CID 174151376
(2R,4R,5S)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)-4-(2-phenylethyl)oxolan-3-ol (PubChem CID 174151376) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is (2R,4R,5S)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)-4-(2-phenylethyl)oxolan-3-ol.
| Compound Name | (2R,4R,5S)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)-4-(2-phenylethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 174151376 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | (2R,4R,5S)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)-4-(2-phenylethyl)oxolan-3-ol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@H](CCc2ccccc2)C1O |
| InChI | InChI=1S/C18H21N5O3/c19-16-14-17(21-9-20-16)23(10-22-14)18-15(25)12(13(8-24)26-18)7-6-11-4-2-1-3-5-11/h1-5,9-10,12-13,15,18,24-25H,6-8H2,(H2,19,20,21)/t12-,13+,15?,18+/m0/s1 |
| InChIKey | XFGXTGRZIIHTIF-VKBXJKCPSA-N |
| XLogP | 0.91 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |