C11H20N2O — CID 174151535
3-imino-1-[(2,2,3,3-tetramethylcyclopropyl)methoxy]prop-1-en-1-amine (PubChem CID 174151535) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 3-imino-1-[(2,2,3,3-tetramethylcyclopropyl)methoxy]prop-1-en-1-amine.
| Compound Name | 3-imino-1-[(2,2,3,3-tetramethylcyclopropyl)methoxy]prop-1-en-1-amine |
|---|---|
| PubChem CID | 174151535 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 3-imino-1-[(2,2,3,3-tetramethylcyclopropyl)methoxy]prop-1-en-1-amine |
| SMILES | [H]/N=C/C=C(N)OCC1C(C)(C)C1(C)C |
| InChI | InChI=1S/C11H20N2O/c1-10(2)8(11(10,3)4)7-14-9(13)5-6-12/h5-6,8,12H,7,13H2,1-4H3/b9-5?,12-6+ |
| InChIKey | QCLCZJZTJAEVAJ-JKZBIOIDSA-N |
| XLogP | 2.13 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|