C23H26Si — CID 174151682
[4-[4-[(1E,3Z,5Z)-cycloocta-1,3,5-trien-1-yl]phenyl]phenyl]-trimethylsilane (PubChem CID 174151682) has the molecular formula C23H26Si and a molecular weight of 330.55 g/mol. Its IUPAC name is [4-[4-[(1E,3Z,5Z)-cycloocta-1,3,5-trien-1-yl]phenyl]phenyl]-trimethylsilane.
| Compound Name | [4-[4-[(1E,3Z,5Z)-cycloocta-1,3,5-trien-1-yl]phenyl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 174151682 |
| Molecular Formula | C23H26Si |
| Molecular Weight | 330.55 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | [4-[4-[(1E,3Z,5Z)-cycloocta-1,3,5-trien-1-yl]phenyl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(-c2ccc(/C3=C/C=C\C=C/CC3)cc2)cc1 |
| InChI | InChI=1S/C23H26Si/c1-24(2,3)23-17-15-22(16-18-23)21-13-11-20(12-14-21)19-9-7-5-4-6-8-10-19/h4-7,9,11-18H,8,10H2,1-3H3/b6-4-,7-5-,19-9+ |
| InChIKey | FRIDAXPNQSKETA-SULRQSTRSA-N |
| XLogP | 6.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.55 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|