C35H34Si — CID 174151684
[4-[4-[4-[4-[(1E,3Z,5Z)-cycloocta-1,3,5-trien-1-yl]phenyl]phenyl]phenyl]phenyl]-trimethylsilane (PubChem CID 174151684) has the molecular formula C35H34Si and a molecular weight of 482.74 g/mol. Its IUPAC name is [4-[4-[4-[4-[(1E,3Z,5Z)-cycloocta-1,3,5-trien-1-yl]phenyl]phenyl]phenyl]phenyl]-trimethylsilane.
| Compound Name | [4-[4-[4-[4-[(1E,3Z,5Z)-cycloocta-1,3,5-trien-1-yl]phenyl]phenyl]phenyl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 174151684 |
| Molecular Formula | C35H34Si |
| Molecular Weight | 482.74 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | [4-[4-[4-[4-[(1E,3Z,5Z)-cycloocta-1,3,5-trien-1-yl]phenyl]phenyl]phenyl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(-c2ccc(-c3ccc(-c4ccc(/C5=C/C=C\C=C/CC5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H34Si/c1-36(2,3)35-25-23-34(24-26-35)33-21-19-32(20-22-33)31-17-15-30(16-18-31)29-13-11-28(12-14-29)27-9-7-5-4-6-8-10-27/h4-7,9,11-26H,8,10H2,1-3H3/b6-4-,7-5-,27-9+ |
| InChIKey | VQLTVYNHCRQDTR-OZZDRUDASA-N |
| XLogP | 9.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.74 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|