C24H28Si — CID 174151690
trimethyl-[4-[4-[(1E,3Z,7E)-5-methylcycloocta-1,3,7-trien-1-yl]phenyl]phenyl]silane (PubChem CID 174151690) has the molecular formula C24H28Si and a molecular weight of 344.57 g/mol. Its IUPAC name is trimethyl-[4-[4-[(1E,3Z,7E)-5-methylcycloocta-1,3,7-trien-1-yl]phenyl]phenyl]silane.
| Compound Name | trimethyl-[4-[4-[(1E,3Z,7E)-5-methylcycloocta-1,3,7-trien-1-yl]phenyl]phenyl]silane |
|---|---|
| PubChem CID | 174151690 |
| Molecular Formula | C24H28Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | trimethyl-[4-[4-[(1E,3Z,7E)-5-methylcycloocta-1,3,7-trien-1-yl]phenyl]phenyl]silane |
| SMILES | CC1/C=C\C=C(c2ccc(-c3ccc([Si](C)(C)C)cc3)cc2)/C=C\C1 |
| InChI | InChI=1S/C24H28Si/c1-19-7-5-9-20(10-6-8-19)21-11-13-22(14-12-21)23-15-17-24(18-16-23)25(2,3)4/h5-7,9-19H,8H2,1-4H3/b7-5-,10-6-,20-9+ |
| InChIKey | HMXHMFLCWJJXBS-IRBYNORUSA-N |
| XLogP | 6.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|