C16H16BF3O4 — CID 174151716
(3S)-1-[1-hydroxy-4-(trifluoromethyl)-3H-2,1-benzoxaborol-6-yl]-3-methylhept-6-ene-1,5-dione (PubChem CID 174151716) has the molecular formula C16H16BF3O4 and a molecular weight of 340.11 g/mol. Its IUPAC name is (3S)-1-[1-hydroxy-4-(trifluoromethyl)-3H-2,1-benzoxaborol-6-yl]-3-methylhept-6-ene-1,5-dione.
| Compound Name | (3S)-1-[1-hydroxy-4-(trifluoromethyl)-3H-2,1-benzoxaborol-6-yl]-3-methylhept-6-ene-1,5-dione |
|---|---|
| PubChem CID | 174151716 |
| Molecular Formula | C16H16BF3O4 |
| Molecular Weight | 340.11 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | (3S)-1-[1-hydroxy-4-(trifluoromethyl)-3H-2,1-benzoxaborol-6-yl]-3-methylhept-6-ene-1,5-dione |
| SMILES | C=CC(=O)C[C@H](C)CC(=O)c1cc2c(c(C(F)(F)F)c1)COB2O |
| InChI | InChI=1S/C16H16BF3O4/c1-3-11(21)4-9(2)5-15(22)10-6-13(16(18,19)20)12-8-24-17(23)14(12)7-10/h3,6-7,9,23H,1,4-5,8H2,2H3/t9-/m0/s1 |
| InChIKey | PLCUXXDUVGQUGW-VIFPVBQESA-N |
| XLogP | 2.28 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.11 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|