C17H28O4Si — CID 174152017
(2Z,3R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxolan-2-ylmethylidene)-3-ethenylcyclopentan-1-one (PubChem CID 174152017) has the molecular formula C17H28O4Si and a molecular weight of 324.49 g/mol. Its IUPAC name is (2Z,3R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxolan-2-ylmethylidene)-3-ethenylcyclopentan-1-one.
| Compound Name | (2Z,3R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxolan-2-ylmethylidene)-3-ethenylcyclopentan-1-one |
|---|---|
| PubChem CID | 174152017 |
| Molecular Formula | C17H28O4Si |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (2Z,3R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxolan-2-ylmethylidene)-3-ethenylcyclopentan-1-one |
| SMILES | C=C[C@@H]1/C(=C/C2OCCO2)C(=O)CC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H28O4Si/c1-7-12-13(10-16-19-8-9-20-16)14(18)11-15(12)21-22(5,6)17(2,3)4/h7,10,12,15-16H,1,8-9,11H2,2-6H3/b13-10-/t12-,15?/m1/s1 |
| InChIKey | SHIFEBSZXOLXHX-FVHPLBPCSA-N |
| XLogP | 3.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|