C23H21BrO4 — CID 174152812
2-[(E)-6-bromo-3,3,5-trimethyl-2-oxohex-5-enyl]-1-hydroxyanthracene-9,10-dione (PubChem CID 174152812) has the molecular formula C23H21BrO4 and a molecular weight of 441.32 g/mol. Its IUPAC name is 2-[(E)-6-bromo-3,3,5-trimethyl-2-oxohex-5-enyl]-1-hydroxyanthracene-9,10-dione.
| Compound Name | 2-[(E)-6-bromo-3,3,5-trimethyl-2-oxohex-5-enyl]-1-hydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 174152812 |
| Molecular Formula | C23H21BrO4 |
| Molecular Weight | 441.32 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | 2-[(E)-6-bromo-3,3,5-trimethyl-2-oxohex-5-enyl]-1-hydroxyanthracene-9,10-dione |
| SMILES | C/C(=C\Br)CC(C)(C)C(=O)Cc1ccc2c(c1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H21BrO4/c1-13(12-24)11-23(2,3)18(25)10-14-8-9-17-19(20(14)26)22(28)16-7-5-4-6-15(16)21(17)27/h4-9,12,26H,10-11H2,1-3H3/b13-12+ |
| InChIKey | MZZAVJYRZHAFCQ-OUKQBFOZSA-N |
| XLogP | 4.99 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.32 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|