C26H40BN10O16 — CID 174153183
CID 174153183 (PubChem CID 174153183) has the molecular formula C26H40BN10O16 and a molecular weight of 759.47 g/mol.
| Compound Name | CID 174153183 |
|---|---|
| PubChem CID | 174153183 |
| Molecular Formula | C26H40BN10O16 |
| Molecular Weight | 759.47 g/mol |
| Exact Mass | 759.27 |
| IUPAC Name | — |
| SMILES | CC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CNC(=O)O[B]OC(=O)NC[C@@H](O)[C@@H](O)[C@@H]2OC(C(=O)O)=C[C@H](N=C(N)N)[C@H]2NC(C)=O)OC(C(=O)O)=C[C@@H]1N=C(N)N |
| InChI | InChI=1S/C26H40BN10O16/c1-7(38)34-15-9(36-23(28)29)3-13(21(44)45)50-19(15)17(42)11(40)5-32-25(48)52-27-53-26(49)33-6-12(41)18(43)20-16(35-8(2)39)10(37-24(30)31)4-14(51-20)22(46)47/h3-4,9-12,15-20,40-43H,5-6H2,1-2H3,(H,32,48)(H,33,49)(H,34,38)(H,35,39)(H,44,45)(H,46,47)(H4,28,29,36)(H4,30,31,37)/t9-,10-,11+,12+,15+,16+,17+,18+,19+,20+/m0/s1 |
| InChIKey | CPDPHJIWXKIFEL-YZLMOWEZSA-N |
| XLogP | -7.56 |
| TPSA | 437.64 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.47 |
| LogP ≤ 5 | -7.56 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|