C8H13F3O4 — CID 174153734
(3R,4R,5R,6R)-6-ethyl-3-(trifluoromethyl)oxane-2,4,5-triol (PubChem CID 174153734) has the molecular formula C8H13F3O4 and a molecular weight of 230.18 g/mol. Its IUPAC name is (3R,4R,5R,6R)-6-ethyl-3-(trifluoromethyl)oxane-2,4,5-triol.
| Compound Name | (3R,4R,5R,6R)-6-ethyl-3-(trifluoromethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 174153734 |
| Molecular Formula | C8H13F3O4 |
| Molecular Weight | 230.18 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | (3R,4R,5R,6R)-6-ethyl-3-(trifluoromethyl)oxane-2,4,5-triol |
| SMILES | CC[C@H]1OC(O)[C@H](C(F)(F)F)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C8H13F3O4/c1-2-3-5(12)6(13)4(7(14)15-3)8(9,10)11/h3-7,12-14H,2H2,1H3/t3-,4-,5+,6-,7?/m1/s1 |
| InChIKey | OUNBWDUTIIJMND-WLDMJGECSA-N |
| XLogP | 0.01 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.18 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |