About CID 174154038
CID 174154038 (PubChem CID 174154038) has the molecular formula C36H19B5N2
and a molecular weight of 533.62 g/mol.
Molecular Properties
| Compound Name | CID 174154038 |
| PubChem CID | 174154038 |
| Molecular Formula | C36H19B5N2 |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2cccc(-c3ccccc3)c2-n2c3ccccc3c3ccc4c5ccccc5[nH]c4c32)c([B])c1[B] |
| InChI | InChI=1S/C36H19B5N2/c37-29-28(30(38)32(40)33(41)31(29)39)25-14-8-13-20(19-9-2-1-3-10-19)35(25)43-27-16-7-5-12-22(27)24-18-17-23-21-11-4-6-15-26(21)42-34(23)36(24)43/h1-18,42H |
| InChIKey | XZLCCIRRTCJABM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174154038 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174154038?
The IUPAC name of CID 174154038 (CID 174154038) is not available.
What is the SMILES notation for CID 174154038?
The canonical SMILES for CID 174154038 is [B]c1c([B])c([B])c(-c2cccc(-c3ccccc3)c2-n2c3ccccc3c3ccc4c5ccccc5[nH]c4c32)c([B])c1[B].
What is the InChIKey of CID 174154038?
The InChIKey is XZLCCIRRTCJABM-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H19B5N2/c37-29-28(30(38)32(40)33(41)31(29)39)25-14-8-13-20(19-9-2-1-3-10-19)35(25)43-27-16-7-5-12-22(27)24-18-17-23-21-11-4-6-15-26(21)42-34(23)36(24)43/h1-18,42H.
What are the key properties of CID 174154038?
CID 174154038 has a molecular weight of 533.62 g/mol, XLogP of 3.72, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174154038 is sourced from PubChem (CID 174154038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).