C18H24FNO — CID 174154406
2-fluoro-5-[[(E)-1-phenylbut-1-enoxy]methyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizine (PubChem CID 174154406) has the molecular formula C18H24FNO and a molecular weight of 289.39 g/mol. Its IUPAC name is 2-fluoro-5-[[(E)-1-phenylbut-1-enoxy]methyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizine.
| Compound Name | 2-fluoro-5-[[(E)-1-phenylbut-1-enoxy]methyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 174154406 |
| Molecular Formula | C18H24FNO |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 2-fluoro-5-[[(E)-1-phenylbut-1-enoxy]methyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
| SMILES | CC/C=C(/OCC1CCC2CC(F)CN12)c1ccccc1 |
| InChI | InChI=1S/C18H24FNO/c1-2-6-18(14-7-4-3-5-8-14)21-13-17-10-9-16-11-15(19)12-20(16)17/h3-8,15-17H,2,9-13H2,1H3/b18-6+ |
| InChIKey | NQJBRGRUSSAXNZ-NGYBGAFCSA-N |
| XLogP | 4.03 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|