C25H41F2N3 — CID 174154408
1-[8-(3,6-dihydro-2H-pyridin-1-yl)-5-(4-fluoro-3,6-dihydro-2H-pyridin-1-yl)nonan-2-yl]-4-fluoro-2,3,6,7-tetrahydroazepine (PubChem CID 174154408) has the molecular formula C25H41F2N3 and a molecular weight of 421.62 g/mol. Its IUPAC name is 1-[8-(3,6-dihydro-2H-pyridin-1-yl)-5-(4-fluoro-3,6-dihydro-2H-pyridin-1-yl)nonan-2-yl]-4-fluoro-2,3,6,7-tetrahydroazepine.
| Compound Name | 1-[8-(3,6-dihydro-2H-pyridin-1-yl)-5-(4-fluoro-3,6-dihydro-2H-pyridin-1-yl)nonan-2-yl]-4-fluoro-2,3,6,7-tetrahydroazepine |
|---|---|
| PubChem CID | 174154408 |
| Molecular Formula | C25H41F2N3 |
| Molecular Weight | 421.62 g/mol |
| Exact Mass | 421.33 |
| IUPAC Name | 1-[8-(3,6-dihydro-2H-pyridin-1-yl)-5-(4-fluoro-3,6-dihydro-2H-pyridin-1-yl)nonan-2-yl]-4-fluoro-2,3,6,7-tetrahydroazepine |
| SMILES | CC(CCC(CCC(C)N1CCC=C(F)CC1)N1CC=C(F)CC1)N1CC=CCC1 |
| InChI | InChI=1S/C25H41F2N3/c1-21(28-15-4-3-5-16-28)8-10-25(30-19-13-24(27)14-20-30)11-9-22(2)29-17-6-7-23(26)12-18-29/h3-4,7,13,21-22,25H,5-6,8-12,14-20H2,1-2H3 |
| InChIKey | LPMMHZCNLCLZIB-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.62 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|