C16H27N3O6S — CID 174154649
tert-butyl N-[[(2R,6S)-7-(carbamothioylamino)-4,4-dimethyl-3,5,8,10-tetraoxatricyclo[5.2.2.02,6]undecan-1-yl]methyl]carbamate (PubChem CID 174154649) has the molecular formula C16H27N3O6S and a molecular weight of 389.47 g/mol. Its IUPAC name is tert-butyl N-[[(2R,6S)-7-(carbamothioylamino)-4,4-dimethyl-3,5,8,10-tetraoxatricyclo[5.2.2.02,6]undecan-1-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(2R,6S)-7-(carbamothioylamino)-4,4-dimethyl-3,5,8,10-tetraoxatricyclo[5.2.2.02,6]undecan-1-yl]methyl]carbamate |
|---|---|
| PubChem CID | 174154649 |
| Molecular Formula | C16H27N3O6S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | tert-butyl N-[[(2R,6S)-7-(carbamothioylamino)-4,4-dimethyl-3,5,8,10-tetraoxatricyclo[5.2.2.02,6]undecan-1-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC12COC(NC(N)=S)(CO1)[C@H]1OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C16H27N3O6S/c1-13(2,3)25-12(20)18-6-15-7-22-16(8-21-15,19-11(17)26)10-9(15)23-14(4,5)24-10/h9-10H,6-8H2,1-5H3,(H,18,20)(H3,17,19,26)/t9-,10+,15?,16?/m1/s1 |
| InChIKey | BGQUKDAXWLSDSF-LOBLKJKISA-N |
| XLogP | 0.36 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|