C19H31N3O7 — CID 174154663
tert-butyl N-[[(2R)-4,4-dimethyl-7-(2-oxo-1,3-diazinan-1-yl)-3,5,8,10-tetraoxatricyclo[5.2.2.02,6]undecan-1-yl]methyl]carbamate (PubChem CID 174154663) has the molecular formula C19H31N3O7 and a molecular weight of 413.47 g/mol. Its IUPAC name is tert-butyl N-[[(2R)-4,4-dimethyl-7-(2-oxo-1,3-diazinan-1-yl)-3,5,8,10-tetraoxatricyclo[5.2.2.02,6]undecan-1-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(2R)-4,4-dimethyl-7-(2-oxo-1,3-diazinan-1-yl)-3,5,8,10-tetraoxatricyclo[5.2.2.02,6]undecan-1-yl]methyl]carbamate |
|---|---|
| PubChem CID | 174154663 |
| Molecular Formula | C19H31N3O7 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | tert-butyl N-[[(2R)-4,4-dimethyl-7-(2-oxo-1,3-diazinan-1-yl)-3,5,8,10-tetraoxatricyclo[5.2.2.02,6]undecan-1-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC12COC(N3CCCNC3=O)(CO1)C1OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C19H31N3O7/c1-16(2,3)29-15(24)21-9-18-10-26-19(11-25-18,22-8-6-7-20-14(22)23)13-12(18)27-17(4,5)28-13/h12-13H,6-11H2,1-5H3,(H,20,23)(H,21,24)/t12-,13?,18?,19?/m1/s1 |
| InChIKey | GUHOYZHXHJZWDP-HZEYAXFUSA-N |
| XLogP | 0.94 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |