C20H40N2O6Si — CID 174154671
tert-butyl N-[[(3aS,7R,7aR)-7-amino-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl]carbamate (PubChem CID 174154671) has the molecular formula C20H40N2O6Si and a molecular weight of 432.63 g/mol. Its IUPAC name is tert-butyl N-[[(3aS,7R,7aR)-7-amino-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(3aS,7R,7aR)-7-amino-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 174154671 |
| Molecular Formula | C20H40N2O6Si |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | tert-butyl N-[[(3aS,7R,7aR)-7-amino-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1OC(O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C20H40N2O6Si/c1-18(2,3)27-17(23)22-11-12-14-15(26-20(7,8)25-14)13(21)16(24-12)28-29(9,10)19(4,5)6/h12-16H,11,21H2,1-10H3,(H,22,23)/t12?,13-,14+,15-,16?/m1/s1 |
| InChIKey | BMGNJXWUGOFSPV-JJCQNKCGSA-N |
| XLogP | 3.11 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|