C15H28N2O6 — CID 174154680
tert-butyl N-[[(3aR,4R,7R,7aR)-7-amino-6-hydroxy-2,2,4-trimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl]carbamate (PubChem CID 174154680) has the molecular formula C15H28N2O6 and a molecular weight of 332.40 g/mol. Its IUPAC name is tert-butyl N-[[(3aR,4R,7R,7aR)-7-amino-6-hydroxy-2,2,4-trimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(3aR,4R,7R,7aR)-7-amino-6-hydroxy-2,2,4-trimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 174154680 |
| Molecular Formula | C15H28N2O6 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | tert-butyl N-[[(3aR,4R,7R,7aR)-7-amino-6-hydroxy-2,2,4-trimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@@]1(C)OC(O)[C@H](N)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C15H28N2O6/c1-13(2,3)23-12(19)17-7-15(6)10-9(8(16)11(18)22-15)20-14(4,5)21-10/h8-11,18H,7,16H2,1-6H3,(H,17,19)/t8-,9-,10-,11?,15-/m1/s1 |
| InChIKey | ISWXFOUWQUJUNL-ZZGYQQLZSA-N |
| XLogP | 0.47 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |