C21H35F3N2O8 — CID 174154824
N-[(1R,2R,6R,7S,8R)-1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxymethyl]-4,4-dimethyl-3,5,11-trioxatricyclo[6.2.1.02,6]undecan-7-yl]-2,2,2-trifluoroacetamide (PubChem CID 174154824) has the molecular formula C21H35F3N2O8 and a molecular weight of 500.51 g/mol. Its IUPAC name is N-[(1R,2R,6R,7S,8R)-1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxymethyl]-4,4-dimethyl-3,5,11-trioxatricyclo[6.2.1.02,6]undecan-7-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1R,2R,6R,7S,8R)-1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxymethyl]-4,4-dimethyl-3,5,11-trioxatricyclo[6.2.1.02,6]undecan-7-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 174154824 |
| Molecular Formula | C21H35F3N2O8 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | N-[(1R,2R,6R,7S,8R)-1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxymethyl]-4,4-dimethyl-3,5,11-trioxatricyclo[6.2.1.02,6]undecan-7-yl]-2,2,2-trifluoroacetamide |
| SMILES | CC1(C)O[C@@H]2[C@@H](NC(=O)C(F)(F)F)[C@H]3CC[C@](COCCOCCOCCOCCN)(O3)[C@@H]2O1 |
| InChI | InChI=1S/C21H35F3N2O8/c1-19(2)33-16-15(26-18(27)21(22,23)24)14-3-4-20(32-14,17(16)34-19)13-31-12-11-30-10-9-29-8-7-28-6-5-25/h14-17H,3-13,25H2,1-2H3,(H,26,27)/t14-,15+,16-,17-,20-/m1/s1 |
| InChIKey | YSWHQWPFJJHUDS-QRXRQMIZSA-N |
| XLogP | 0.51 |
| TPSA | 119.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|