About 2-methylpropane;tribromotitanium
2-methylpropane;tribromotitanium (PubChem CID 174154914) has the molecular formula C4H10Br3Ti
and a molecular weight of 345.70 g/mol. Its IUPAC name is 2-methylpropane;tribromotitanium.
Molecular Properties
| Compound Name | 2-methylpropane;tribromotitanium |
| PubChem CID | 174154914 |
| Molecular Formula | C4H10Br3Ti |
| Molecular Weight | 345.70 g/mol |
| Exact Mass | 342.78 |
| IUPAC Name | 2-methylpropane;tribromotitanium |
| SMILES | Br[Ti](Br)Br.CC(C)C |
| InChI | InChI=1S/C4H10.3BrH.Ti/c1-4(2)3;;;;/h4H,1-3H3;3*1H;/q;;;;+3/p-3 |
| InChIKey | WLDNPFBWHQWZJO-UHFFFAOYSA-K |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.70 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-methylpropane;tribromotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;tribromotitanium?
The IUPAC name of 2-methylpropane;tribromotitanium (CID 174154914) is 2-methylpropane;tribromotitanium.
What is the SMILES notation for 2-methylpropane;tribromotitanium?
The canonical SMILES for 2-methylpropane;tribromotitanium is Br[Ti](Br)Br.CC(C)C.
What is the InChIKey of 2-methylpropane;tribromotitanium?
The InChIKey is WLDNPFBWHQWZJO-UHFFFAOYSA-K. The full InChI is InChI=1S/C4H10.3BrH.Ti/c1-4(2)3;;;;/h4H,1-3H3;3*1H;/q;;;;+3/p-3.
What are the key properties of 2-methylpropane;tribromotitanium?
2-methylpropane;tribromotitanium has a molecular weight of 345.70 g/mol, XLogP of 4.20, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;tribromotitanium is sourced from PubChem (CID 174154914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).