C29H38N2O2P+ — CID 174155032
10-(carbamoylamino)oxydecyl-triphenylphosphanium (PubChem CID 174155032) has the molecular formula C29H38N2O2P+ and a molecular weight of 477.61 g/mol. Its IUPAC name is 10-(carbamoylamino)oxydecyl-triphenylphosphanium.
| Compound Name | 10-(carbamoylamino)oxydecyl-triphenylphosphanium |
|---|---|
| PubChem CID | 174155032 |
| Molecular Formula | C29H38N2O2P+ |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | 10-(carbamoylamino)oxydecyl-triphenylphosphanium |
| SMILES | NC(=O)NOCCCCCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H37N2O2P/c30-29(32)31-33-24-16-5-3-1-2-4-6-17-25-34(26-18-10-7-11-19-26,27-20-12-8-13-21-27)28-22-14-9-15-23-28/h7-15,18-23H,1-6,16-17,24-25H2,(H2-,30,31,32)/p+1 |
| InChIKey | QUTXVJJXZMMRID-UHFFFAOYSA-O |
| XLogP | 5.70 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|