C32H38F3N3O4P+ — CID 174155062
triphenyl-[10-[(2,2,2-trifluoroacetyl)oxycarbamoylcarbamoylamino]decyl]phosphanium (PubChem CID 174155062) has the molecular formula C32H38F3N3O4P+ and a molecular weight of 616.64 g/mol. Its IUPAC name is triphenyl-[10-[(2,2,2-trifluoroacetyl)oxycarbamoylcarbamoylamino]decyl]phosphanium.
| Compound Name | triphenyl-[10-[(2,2,2-trifluoroacetyl)oxycarbamoylcarbamoylamino]decyl]phosphanium |
|---|---|
| PubChem CID | 174155062 |
| Molecular Formula | C32H38F3N3O4P+ |
| Molecular Weight | 616.64 g/mol |
| Exact Mass | 616.25 |
| IUPAC Name | triphenyl-[10-[(2,2,2-trifluoroacetyl)oxycarbamoylcarbamoylamino]decyl]phosphanium |
| SMILES | O=C(NCCCCCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)NOC(=O)C(F)(F)F |
| InChI | InChI=1S/C32H37F3N3O4P/c33-32(34,35)29(39)42-38-31(41)37-30(40)36-24-16-5-3-1-2-4-6-17-25-43(26-18-10-7-11-19-26,27-20-12-8-13-21-27)28-22-14-9-15-23-28/h7-15,18-23H,1-6,16-17,24-25H2,(H2-,36,37,38,40,41)/p+1 |
| InChIKey | KUFWWDURYPSZAP-UHFFFAOYSA-O |
| XLogP | 6.13 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.64 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|