C24H33F3N2O3Si — CID 174155718
[2-[3-[tert-butyl(diphenyl)silyl]oxypropyl-methylamino]-3,3,3-trifluoropropyl] carbamate (PubChem CID 174155718) has the molecular formula C24H33F3N2O3Si and a molecular weight of 482.62 g/mol. Its IUPAC name is [2-[3-[tert-butyl(diphenyl)silyl]oxypropyl-methylamino]-3,3,3-trifluoropropyl] carbamate.
| Compound Name | [2-[3-[tert-butyl(diphenyl)silyl]oxypropyl-methylamino]-3,3,3-trifluoropropyl] carbamate |
|---|---|
| PubChem CID | 174155718 |
| Molecular Formula | C24H33F3N2O3Si |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | [2-[3-[tert-butyl(diphenyl)silyl]oxypropyl-methylamino]-3,3,3-trifluoropropyl] carbamate |
| SMILES | CN(CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(COC(N)=O)C(F)(F)F |
| InChI | InChI=1S/C24H33F3N2O3Si/c1-23(2,3)33(19-12-7-5-8-13-19,20-14-9-6-10-15-20)32-17-11-16-29(4)21(24(25,26)27)18-31-22(28)30/h5-10,12-15,21H,11,16-18H2,1-4H3,(H2,28,30) |
| InChIKey | ZUOOOQSPWFNERQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|