C19H30N6O4Si — CID 174155773
5-[5-ethyl-4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-3-nitro-N-(oxetan-2-ylmethyl)pyridin-2-amine (PubChem CID 174155773) has the molecular formula C19H30N6O4Si and a molecular weight of 434.57 g/mol. Its IUPAC name is 5-[5-ethyl-4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-3-nitro-N-(oxetan-2-ylmethyl)pyridin-2-amine.
| Compound Name | 5-[5-ethyl-4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-3-nitro-N-(oxetan-2-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 174155773 |
| Molecular Formula | C19H30N6O4Si |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 5-[5-ethyl-4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-3-nitro-N-(oxetan-2-ylmethyl)pyridin-2-amine |
| SMILES | CCc1nnc(-c2cnc(NCC3CCO3)c([N+](=O)[O-])c2)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C19H30N6O4Si/c1-5-17-22-23-19(24(17)13-28-8-9-30(2,3)4)14-10-16(25(26)27)18(20-11-14)21-12-15-6-7-29-15/h10-11,15H,5-9,12-13H2,1-4H3,(H,20,21) |
| InChIKey | HRGVZZQLLRZUND-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|