C21H22N2O3 — CID 17415591
3-[5-(3,4-dimethylphenyl)-1,3-oxazol-2-yl]-N-(2-hydroxy-4-methylphenyl)propanamide (PubChem CID 17415591) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 3-[5-(3,4-dimethylphenyl)-1,3-oxazol-2-yl]-N-(2-hydroxy-4-methylphenyl)propanamide.
| Compound Name | 3-[5-(3,4-dimethylphenyl)-1,3-oxazol-2-yl]-N-(2-hydroxy-4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 17415591 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 3-[5-(3,4-dimethylphenyl)-1,3-oxazol-2-yl]-N-(2-hydroxy-4-methylphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)CCc2ncc(-c3ccc(C)c(C)c3)o2)c(O)c1 |
| InChI | InChI=1S/C21H22N2O3/c1-13-4-7-17(18(24)10-13)23-20(25)8-9-21-22-12-19(26-21)16-6-5-14(2)15(3)11-16/h4-7,10-12,24H,8-9H2,1-3H3,(H,23,25) |
| InChIKey | STUJRLPRVKBJSN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|