About tert-butyl-[(6-methyl-1,1-dioxo-1,4-thiazinan-3-yl)methoxy]-diphenylsilane
tert-butyl-[(6-methyl-1,1-dioxo-1,4-thiazinan-3-yl)methoxy]-diphenylsilane (PubChem CID 174155987) has the molecular formula C22H31NO3SSi
and a molecular weight of 417.65 g/mol. Its IUPAC name is tert-butyl-[(6-methyl-1,1-dioxo-1,4-thiazinan-3-yl)methoxy]-diphenylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(6-methyl-1,1-dioxo-1,4-thiazinan-3-yl)methoxy]-diphenylsilane |
| PubChem CID | 174155987 |
| Molecular Formula | C22H31NO3SSi |
| Molecular Weight | 417.65 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | tert-butyl-[(6-methyl-1,1-dioxo-1,4-thiazinan-3-yl)methoxy]-diphenylsilane |
| SMILES | CC1CNC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CS1(=O)=O |
| InChI | InChI=1S/C22H31NO3SSi/c1-18-15-23-19(17-27(18,24)25)16-26-28(22(2,3)4,20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-14,18-19,23H,15-17H2,1-4H3 |
| InChIKey | IACIYDDUTAYGGZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.65 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(6-methyl-1,1-dioxo-1,4-thiazinan-3-yl)methoxy]-diphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(6-methyl-1,1-dioxo-1,4-thiazinan-3-yl)methoxy]-diphenylsilane?
The IUPAC name of tert-butyl-[(6-methyl-1,1-dioxo-1,4-thiazinan-3-yl)methoxy]-diphenylsilane (CID 174155987) is tert-butyl-[(6-methyl-1,1-dioxo-1,4-thiazinan-3-yl)methoxy]-diphenylsilane.
What is the SMILES notation for tert-butyl-[(6-methyl-1,1-dioxo-1,4-thiazinan-3-yl)methoxy]-diphenylsilane?
The canonical SMILES for tert-butyl-[(6-methyl-1,1-dioxo-1,4-thiazinan-3-yl)methoxy]-diphenylsilane is CC1CNC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CS1(=O)=O.
What is the InChIKey of tert-butyl-[(6-methyl-1,1-dioxo-1,4-thiazinan-3-yl)methoxy]-diphenylsilane?
The InChIKey is IACIYDDUTAYGGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31NO3SSi/c1-18-15-23-19(17-27(18,24)25)16-26-28(22(2,3)4,20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-14,18-19,23H,15-17H2,1-4H3.
What are the key properties of tert-butyl-[(6-methyl-1,1-dioxo-1,4-thiazinan-3-yl)methoxy]-diphenylsilane?
tert-butyl-[(6-methyl-1,1-dioxo-1,4-thiazinan-3-yl)methoxy]-diphenylsilane has a molecular weight of 417.65 g/mol, XLogP of 2.34, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(6-methyl-1,1-dioxo-1,4-thiazinan-3-yl)methoxy]-diphenylsilane is sourced from PubChem (CID 174155987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).