C29H40N4O3Si — CID 174156498
tert-butyl 2-[1-[2-(4,4-dimethyl-1,4-azasilinan-1-yl)-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylamino]benzoate (PubChem CID 174156498) has the molecular formula C29H40N4O3Si and a molecular weight of 520.75 g/mol. Its IUPAC name is tert-butyl 2-[1-[2-(4,4-dimethyl-1,4-azasilinan-1-yl)-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylamino]benzoate.
| Compound Name | tert-butyl 2-[1-[2-(4,4-dimethyl-1,4-azasilinan-1-yl)-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylamino]benzoate |
|---|---|
| PubChem CID | 174156498 |
| Molecular Formula | C29H40N4O3Si |
| Molecular Weight | 520.75 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | tert-butyl 2-[1-[2-(4,4-dimethyl-1,4-azasilinan-1-yl)-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylamino]benzoate |
| SMILES | Cc1cc(C(C)Nc2ccccc2C(=O)OC(C)(C)C)c2nc(N3CC[Si](C)(C)CC3)n(C)c(=O)c2c1 |
| InChI | InChI=1S/C29H40N4O3Si/c1-19-17-22(20(2)30-24-12-10-9-11-21(24)27(35)36-29(3,4)5)25-23(18-19)26(34)32(6)28(31-25)33-13-15-37(7,8)16-14-33/h9-12,17-18,20,30H,13-16H2,1-8H3 |
| InChIKey | BMGQTUQGDHHCAM-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.75 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|