C14H26BN3O5 — CID 174156552
(3aS,4R,6aR)-1-[(2S)-2-aminopropanoyl]-4-(4-boronobutyl)-2,3,3a,5,6,6a-hexahydropyrrolo[2,3-c]pyrrole-4-carboxylic acid (PubChem CID 174156552) has the molecular formula C14H26BN3O5 and a molecular weight of 327.19 g/mol. Its IUPAC name is (3aS,4R,6aR)-1-[(2S)-2-aminopropanoyl]-4-(4-boronobutyl)-2,3,3a,5,6,6a-hexahydropyrrolo[2,3-c]pyrrole-4-carboxylic acid.
| Compound Name | (3aS,4R,6aR)-1-[(2S)-2-aminopropanoyl]-4-(4-boronobutyl)-2,3,3a,5,6,6a-hexahydropyrrolo[2,3-c]pyrrole-4-carboxylic acid |
|---|---|
| PubChem CID | 174156552 |
| Molecular Formula | C14H26BN3O5 |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | (3aS,4R,6aR)-1-[(2S)-2-aminopropanoyl]-4-(4-boronobutyl)-2,3,3a,5,6,6a-hexahydropyrrolo[2,3-c]pyrrole-4-carboxylic acid |
| SMILES | C[C@H](N)C(=O)N1CC[C@H]2[C@@H]1CN[C@@]2(CCCCB(O)O)C(=O)O |
| InChI | InChI=1S/C14H26BN3O5/c1-9(16)12(19)18-7-4-10-11(18)8-17-14(10,13(20)21)5-2-3-6-15(22)23/h9-11,17,22-23H,2-8,16H2,1H3,(H,20,21)/t9-,10-,11-,14+/m0/s1 |
| InChIKey | RWPPPWSOJHILGK-AYGWYOGXSA-N |
| XLogP | -1.38 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|