C21H18N4O3 — CID 174156657
N'-hydroxy-3-(10-methyl-2,4-dioxo-1H-benzo[i][1,5]benzodiazepin-5-yl)benzenecarboximidamide (PubChem CID 174156657) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is N'-hydroxy-3-(10-methyl-2,4-dioxo-1H-benzo[i][1,5]benzodiazepin-5-yl)benzenecarboximidamide.
| Compound Name | N'-hydroxy-3-(10-methyl-2,4-dioxo-1H-benzo[i][1,5]benzodiazepin-5-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 174156657 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N'-hydroxy-3-(10-methyl-2,4-dioxo-1H-benzo[i][1,5]benzodiazepin-5-yl)benzenecarboximidamide |
| SMILES | Cc1ccc2ccc3c(c2c1)NC(=O)CC(=O)N3c1cccc(C(N)=NO)c1 |
| InChI | InChI=1S/C21H18N4O3/c1-12-5-6-13-7-8-17-20(16(13)9-12)23-18(26)11-19(27)25(17)15-4-2-3-14(10-15)21(22)24-28/h2-10,28H,11H2,1H3,(H2,22,24)(H,23,26) |
| InChIKey | FKXJWCVJGLAENX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|