C23H37BFN3O4 — CID 174156935
tert-butyl N-[4-[2-amino-4-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-methyliminobutyl]-N-methylcarbamate (PubChem CID 174156935) has the molecular formula C23H37BFN3O4 and a molecular weight of 449.38 g/mol. Its IUPAC name is tert-butyl N-[4-[2-amino-4-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-methyliminobutyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-[2-amino-4-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-methyliminobutyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 174156935 |
| Molecular Formula | C23H37BFN3O4 |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | tert-butyl N-[4-[2-amino-4-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-methyliminobutyl]-N-methylcarbamate |
| SMILES | C/N=C(\CCCN(C)C(=O)OC(C)(C)C)c1c(N)cc(F)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C23H37BFN3O4/c1-21(2,3)30-20(29)28(9)12-10-11-18(27-8)19-16(13-15(25)14-17(19)26)24-31-22(4,5)23(6,7)32-24/h13-14H,10-12,26H2,1-9H3/b27-18+ |
| InChIKey | QSCAADRBQAGGMK-OVVQPSECSA-N |
| XLogP | 3.77 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|