About 5-amino-4-hydroxy-3,4-dihydro-1H-pyrimidin-2-one
5-amino-4-hydroxy-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 174157127) has the molecular formula C4H7N3O2
and a molecular weight of 129.12 g/mol. Its IUPAC name is 5-amino-4-hydroxy-3,4-dihydro-1H-pyrimidin-2-one.
Molecular Properties
| Compound Name | 5-amino-4-hydroxy-3,4-dihydro-1H-pyrimidin-2-one |
| PubChem CID | 174157127 |
| Molecular Formula | C4H7N3O2 |
| Molecular Weight | 129.12 g/mol |
| Exact Mass | 129.05 |
| IUPAC Name | 5-amino-4-hydroxy-3,4-dihydro-1H-pyrimidin-2-one |
| SMILES | NC1=CNC(=O)NC1O |
| InChI | InChI=1S/C4H7N3O2/c5-2-1-6-4(9)7-3(2)8/h1,3,8H,5H2,(H2,6,7,9) |
| InChIKey | YVDIKGMWIWIDLG-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.12 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-amino-4-hydroxy-3,4-dihydro-1H-pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-hydroxy-3,4-dihydro-1H-pyrimidin-2-one?
The IUPAC name of 5-amino-4-hydroxy-3,4-dihydro-1H-pyrimidin-2-one (CID 174157127) is 5-amino-4-hydroxy-3,4-dihydro-1H-pyrimidin-2-one.
What is the SMILES notation for 5-amino-4-hydroxy-3,4-dihydro-1H-pyrimidin-2-one?
The canonical SMILES for 5-amino-4-hydroxy-3,4-dihydro-1H-pyrimidin-2-one is NC1=CNC(=O)NC1O.
What is the InChIKey of 5-amino-4-hydroxy-3,4-dihydro-1H-pyrimidin-2-one?
The InChIKey is YVDIKGMWIWIDLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3O2/c5-2-1-6-4(9)7-3(2)8/h1,3,8H,5H2,(H2,6,7,9).
What are the key properties of 5-amino-4-hydroxy-3,4-dihydro-1H-pyrimidin-2-one?
5-amino-4-hydroxy-3,4-dihydro-1H-pyrimidin-2-one has a molecular weight of 129.12 g/mol, XLogP of -1.58, 0 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-hydroxy-3,4-dihydro-1H-pyrimidin-2-one is sourced from PubChem (CID 174157127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).