About 1,2-benzothiazepin-3-yl carbamate
1,2-benzothiazepin-3-yl carbamate (PubChem CID 174157496) has the molecular formula C10H8N2O2S
and a molecular weight of 220.25 g/mol. Its IUPAC name is 1,2-benzothiazepin-3-yl carbamate.
Molecular Properties
| Compound Name | 1,2-benzothiazepin-3-yl carbamate |
| PubChem CID | 174157496 |
| Molecular Formula | C10H8N2O2S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 1,2-benzothiazepin-3-yl carbamate |
| SMILES | NC(=O)OC1=NSc2ccccc2C=C1 |
| InChI | InChI=1S/C10H8N2O2S/c11-10(13)14-9-6-5-7-3-1-2-4-8(7)15-12-9/h1-6H,(H2,11,13) |
| InChIKey | KIVLGIUJYJXYDU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-benzothiazepin-3-yl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-benzothiazepin-3-yl carbamate?
The IUPAC name of 1,2-benzothiazepin-3-yl carbamate (CID 174157496) is 1,2-benzothiazepin-3-yl carbamate.
What is the SMILES notation for 1,2-benzothiazepin-3-yl carbamate?
The canonical SMILES for 1,2-benzothiazepin-3-yl carbamate is NC(=O)OC1=NSc2ccccc2C=C1.
What is the InChIKey of 1,2-benzothiazepin-3-yl carbamate?
The InChIKey is KIVLGIUJYJXYDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2S/c11-10(13)14-9-6-5-7-3-1-2-4-8(7)15-12-9/h1-6H,(H2,11,13).
What are the key properties of 1,2-benzothiazepin-3-yl carbamate?
1,2-benzothiazepin-3-yl carbamate has a molecular weight of 220.25 g/mol, XLogP of 2.21, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-benzothiazepin-3-yl carbamate is sourced from PubChem (CID 174157496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).