C8H17N3O3 — CID 174157890
[(3S)-1-hydrazinyl-5-methyl-1-oxohexan-3-yl]carbamic acid (PubChem CID 174157890) has the molecular formula C8H17N3O3 and a molecular weight of 203.24 g/mol. Its IUPAC name is [(3S)-1-hydrazinyl-5-methyl-1-oxohexan-3-yl]carbamic acid.
| Compound Name | [(3S)-1-hydrazinyl-5-methyl-1-oxohexan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 174157890 |
| Molecular Formula | C8H17N3O3 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | [(3S)-1-hydrazinyl-5-methyl-1-oxohexan-3-yl]carbamic acid |
| SMILES | CC(C)C[C@@H](CC(=O)NN)NC(=O)O |
| InChI | InChI=1S/C8H17N3O3/c1-5(2)3-6(10-8(13)14)4-7(12)11-9/h5-6,10H,3-4,9H2,1-2H3,(H,11,12)(H,13,14)/t6-/m0/s1 |
| InChIKey | BUFYWVGKQFMTIZ-LURJTMIESA-N |
| XLogP | 0.05 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|