About [(3R)-3-amino-4-oxo-4-(2,2,2-trifluoroacetyl)oxybutyl]-trimethylazanium
[(3R)-3-amino-4-oxo-4-(2,2,2-trifluoroacetyl)oxybutyl]-trimethylazanium (PubChem CID 174158008) has the molecular formula C9H16F3N2O3+
and a molecular weight of 257.23 g/mol. Its IUPAC name is [(3R)-3-amino-4-oxo-4-(2,2,2-trifluoroacetyl)oxybutyl]-trimethylazanium.
Molecular Properties
| Compound Name | [(3R)-3-amino-4-oxo-4-(2,2,2-trifluoroacetyl)oxybutyl]-trimethylazanium |
| PubChem CID | 174158008 |
| Molecular Formula | C9H16F3N2O3+ |
| Molecular Weight | 257.23 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | [(3R)-3-amino-4-oxo-4-(2,2,2-trifluoroacetyl)oxybutyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC[C@@H](N)C(=O)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H16F3N2O3/c1-14(2,3)5-4-6(13)7(15)17-8(16)9(10,11)12/h6H,4-5,13H2,1-3H3/q+1/t6-/m1/s1 |
| InChIKey | KDNCTBBGZJSSCW-ZCFIWIBFSA-N |
| XLogP | 0.04 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.23 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-3-amino-4-oxo-4-(2,2,2-trifluoroacetyl)oxybutyl]-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-3-amino-4-oxo-4-(2,2,2-trifluoroacetyl)oxybutyl]-trimethylazanium?
The IUPAC name of [(3R)-3-amino-4-oxo-4-(2,2,2-trifluoroacetyl)oxybutyl]-trimethylazanium (CID 174158008) is [(3R)-3-amino-4-oxo-4-(2,2,2-trifluoroacetyl)oxybutyl]-trimethylazanium.
What is the SMILES notation for [(3R)-3-amino-4-oxo-4-(2,2,2-trifluoroacetyl)oxybutyl]-trimethylazanium?
The canonical SMILES for [(3R)-3-amino-4-oxo-4-(2,2,2-trifluoroacetyl)oxybutyl]-trimethylazanium is C[N+](C)(C)CC[C@@H](N)C(=O)OC(=O)C(F)(F)F.
What is the InChIKey of [(3R)-3-amino-4-oxo-4-(2,2,2-trifluoroacetyl)oxybutyl]-trimethylazanium?
The InChIKey is KDNCTBBGZJSSCW-ZCFIWIBFSA-N. The full InChI is InChI=1S/C9H16F3N2O3/c1-14(2,3)5-4-6(13)7(15)17-8(16)9(10,11)12/h6H,4-5,13H2,1-3H3/q+1/t6-/m1/s1.
What are the key properties of [(3R)-3-amino-4-oxo-4-(2,2,2-trifluoroacetyl)oxybutyl]-trimethylazanium?
[(3R)-3-amino-4-oxo-4-(2,2,2-trifluoroacetyl)oxybutyl]-trimethylazanium has a molecular weight of 257.23 g/mol, XLogP of 0.04, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-3-amino-4-oxo-4-(2,2,2-trifluoroacetyl)oxybutyl]-trimethylazanium is sourced from PubChem (CID 174158008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).