C25H26F4N2O6 — CID 174158020
[(2R,4S,5R)-2-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-5-[(2S)-1,1,1-trifluoro-3-hydroxypropan-2-yl]oxyoxan-4-yl]carbamic acid (PubChem CID 174158020) has the molecular formula C25H26F4N2O6 and a molecular weight of 526.48 g/mol. Its IUPAC name is [(2R,4S,5R)-2-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-5-[(2S)-1,1,1-trifluoro-3-hydroxypropan-2-yl]oxyoxan-4-yl]carbamic acid.
| Compound Name | [(2R,4S,5R)-2-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-5-[(2S)-1,1,1-trifluoro-3-hydroxypropan-2-yl]oxyoxan-4-yl]carbamic acid |
|---|---|
| PubChem CID | 174158020 |
| Molecular Formula | C25H26F4N2O6 |
| Molecular Weight | 526.48 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | [(2R,4S,5R)-2-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-5-[(2S)-1,1,1-trifluoro-3-hydroxypropan-2-yl]oxyoxan-4-yl]carbamic acid |
| SMILES | O=C(O)N[C@H]1C[C@H](C(=O)N2CCc3ccccc3[C@@H]2c2ccc(F)cc2)OC[C@@H]1O[C@@H](CO)C(F)(F)F |
| InChI | InChI=1S/C25H26F4N2O6/c26-16-7-5-15(6-8-16)22-17-4-2-1-3-14(17)9-10-31(22)23(33)19-11-18(30-24(34)35)20(13-36-19)37-21(12-32)25(27,28)29/h1-8,18-22,30,32H,9-13H2,(H,34,35)/t18-,19+,20-,21-,22-/m0/s1 |
| InChIKey | NOQAQKOKODQQAI-WIYBCGNWSA-N |
| XLogP | 3.03 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |