C30H43FN2O5Si — CID 174158029
[(2R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]oxan-2-yl]-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone;formic acid (PubChem CID 174158029) has the molecular formula C30H43FN2O5Si and a molecular weight of 558.77 g/mol. Its IUPAC name is [(2R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]oxan-2-yl]-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone;formic acid.
| Compound Name | [(2R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]oxan-2-yl]-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone;formic acid |
|---|---|
| PubChem CID | 174158029 |
| Molecular Formula | C30H43FN2O5Si |
| Molecular Weight | 558.77 g/mol |
| Exact Mass | 558.29 |
| IUPAC Name | [(2R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]oxan-2-yl]-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone;formic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCCN[C@@H]1CC[C@H](C(=O)N2CCc3ccccc3[C@@H]2c2ccc(F)cc2)OC1.O=CO |
| InChI | InChI=1S/C29H41FN2O3Si.CH2O2/c1-29(2,3)36(4,5)35-19-17-31-24-14-15-26(34-20-24)28(33)32-18-16-21-8-6-7-9-25(21)27(32)22-10-12-23(30)13-11-22;2-1-3/h6-13,24,26-27,31H,14-20H2,1-5H3;1H,(H,2,3)/t24-,26-,27+;/m1./s1 |
| InChIKey | MOVKJBRTLKUOFT-QMGCZBMQSA-N |
| XLogP | 5.16 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.77 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|