C23H24FN3O — CID 174159021
(6aR,9R)-N-ethyl-7-(2-fluoroprop-2-enyl)-N-prop-2-ynyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 174159021) has the molecular formula C23H24FN3O and a molecular weight of 377.46 g/mol. Its IUPAC name is (6aR,9R)-N-ethyl-7-(2-fluoroprop-2-enyl)-N-prop-2-ynyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9R)-N-ethyl-7-(2-fluoroprop-2-enyl)-N-prop-2-ynyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 174159021 |
| Molecular Formula | C23H24FN3O |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | (6aR,9R)-N-ethyl-7-(2-fluoroprop-2-enyl)-N-prop-2-ynyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | C#CCN(CC)C(=O)[C@@H]1C=C2c3cccc4[nH]cc(c34)C[C@H]2N(CC(=C)F)C1 |
| InChI | InChI=1S/C23H24FN3O/c1-4-9-26(5-2)23(28)17-10-19-18-7-6-8-20-22(18)16(12-25-20)11-21(19)27(14-17)13-15(3)24/h1,6-8,10,12,17,21,25H,3,5,9,11,13-14H2,2H3/t17-,21-/m1/s1 |
| InChIKey | VVAFTWZVAAWPCP-DYESRHJHSA-N |
| XLogP | 3.37 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|