C28H35BF2N4O6S — CID 174159061
N-[2,6-difluoro-3-[1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[5,4-b]pyridine-3-carbonyl]phenyl]butane-1-sulfonamide (PubChem CID 174159061) has the molecular formula C28H35BF2N4O6S and a molecular weight of 604.49 g/mol. Its IUPAC name is N-[2,6-difluoro-3-[1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[5,4-b]pyridine-3-carbonyl]phenyl]butane-1-sulfonamide.
| Compound Name | N-[2,6-difluoro-3-[1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[5,4-b]pyridine-3-carbonyl]phenyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 174159061 |
| Molecular Formula | C28H35BF2N4O6S |
| Molecular Weight | 604.49 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | N-[2,6-difluoro-3-[1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[5,4-b]pyridine-3-carbonyl]phenyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)Nc1c(F)ccc(C(=O)c2nn(C3CCCCO3)c3ncc(B4OC(C)(C)C(C)(C)O4)cc23)c1F |
| InChI | InChI=1S/C28H35BF2N4O6S/c1-6-7-14-42(37,38)34-24-20(30)12-11-18(22(24)31)25(36)23-19-15-17(29-40-27(2,3)28(4,5)41-29)16-32-26(19)35(33-23)21-10-8-9-13-39-21/h11-12,15-16,21,34H,6-10,13-14H2,1-5H3 |
| InChIKey | HWLWERMJJCOAJR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 121.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|