C44H56O4 — CID 174159069
benzhydryl (2S,4aS,6aR,6aS,6bR,8aR,9R,10S,12aS,14bR)-9-formyl-2,4a,6a,6b,9,10,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylate (PubChem CID 174159069) has the molecular formula C44H56O4 and a molecular weight of 648.93 g/mol. Its IUPAC name is benzhydryl (2S,4aS,6aR,6aS,6bR,8aR,9R,10S,12aS,14bR)-9-formyl-2,4a,6a,6b,9,10,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylate.
| Compound Name | benzhydryl (2S,4aS,6aR,6aS,6bR,8aR,9R,10S,12aS,14bR)-9-formyl-2,4a,6a,6b,9,10,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylate |
|---|---|
| PubChem CID | 174159069 |
| Molecular Formula | C44H56O4 |
| Molecular Weight | 648.93 g/mol |
| Exact Mass | 648.42 |
| IUPAC Name | benzhydryl (2S,4aS,6aR,6aS,6bR,8aR,9R,10S,12aS,14bR)-9-formyl-2,4a,6a,6b,9,10,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylate |
| SMILES | C[C@H]1CC[C@]2(C)[C@H]3C(=O)C=C4[C@@H]5C[C@@](C)(C(=O)OC(c6ccccc6)c6ccccc6)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@H]2[C@]1(C)C=O |
| InChI | InChI=1S/C44H56O4/c1-29-18-20-41(4)35(42(29,5)28-45)19-21-44(7)37(41)34(46)26-32-33-27-40(3,23-22-39(33,2)24-25-43(32,44)6)38(47)48-36(30-14-10-8-11-15-30)31-16-12-9-13-17-31/h8-17,26,28-29,33,35-37H,18-25,27H2,1-7H3/t29-,33-,35+,37+,39+,40-,41-,42+,43+,44+/m0/s1 |
| InChIKey | QJXIOOUQTLYRFT-WTWOHZQMSA-N |
| XLogP | 10.11 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.93 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|