C28H37N11O — CID 174159443
(7R)-N-[3-[(1Z,3E)-1-[(3S)-4-ethyl-3-methylpiperazin-1-yl]-1-(methylideneamino)penta-1,3-dien-3-yl]-1H-indazol-5-yl]-4,5,7-trimethyl-7H-tetrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 174159443) has the molecular formula C28H37N11O and a molecular weight of 543.68 g/mol. Its IUPAC name is (7R)-N-[3-[(1Z,3E)-1-[(3S)-4-ethyl-3-methylpiperazin-1-yl]-1-(methylideneamino)penta-1,3-dien-3-yl]-1H-indazol-5-yl]-4,5,7-trimethyl-7H-tetrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7R)-N-[3-[(1Z,3E)-1-[(3S)-4-ethyl-3-methylpiperazin-1-yl]-1-(methylideneamino)penta-1,3-dien-3-yl]-1H-indazol-5-yl]-4,5,7-trimethyl-7H-tetrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 174159443 |
| Molecular Formula | C28H37N11O |
| Molecular Weight | 543.68 g/mol |
| Exact Mass | 543.32 |
| IUPAC Name | (7R)-N-[3-[(1Z,3E)-1-[(3S)-4-ethyl-3-methylpiperazin-1-yl]-1-(methylideneamino)penta-1,3-dien-3-yl]-1H-indazol-5-yl]-4,5,7-trimethyl-7H-tetrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | C=N/C(=C\C(=C/C)c1n[nH]c2ccc(NC(=O)C3=C(C)N(C)c4nnnn4[C@@H]3C)cc12)N1CCN(CC)[C@@H](C)C1 |
| InChI | InChI=1S/C28H37N11O/c1-8-20(14-24(29-6)38-13-12-37(9-2)17(3)16-38)26-22-15-21(10-11-23(22)31-32-26)30-27(40)25-18(4)36(7)28-33-34-35-39(28)19(25)5/h8,10-11,14-15,17,19H,6,9,12-13,16H2,1-5,7H3,(H,30,40)(H,31,32)/b20-8+,24-14+/t17-,19+/m0/s1 |
| InChIKey | LLPLKBRCEKPDJL-NHRAAVCUSA-N |
| XLogP | 3.44 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.68 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|