About 2-amino-3-(7-cyano-1,3-benzoxazol-2-yl)-N-(1-cyanocyclopropyl)prop-2-enamide
2-amino-3-(7-cyano-1,3-benzoxazol-2-yl)-N-(1-cyanocyclopropyl)prop-2-enamide (PubChem CID 174159519) has the molecular formula C15H11N5O2
and a molecular weight of 293.29 g/mol. Its IUPAC name is 2-amino-3-(7-cyano-1,3-benzoxazol-2-yl)-N-(1-cyanocyclopropyl)prop-2-enamide.
Molecular Properties
| Compound Name | 2-amino-3-(7-cyano-1,3-benzoxazol-2-yl)-N-(1-cyanocyclopropyl)prop-2-enamide |
| PubChem CID | 174159519 |
| Molecular Formula | C15H11N5O2 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2-amino-3-(7-cyano-1,3-benzoxazol-2-yl)-N-(1-cyanocyclopropyl)prop-2-enamide |
| SMILES | N#Cc1cccc2nc(C=C(N)C(=O)NC3(C#N)CC3)oc12 |
| InChI | InChI=1S/C15H11N5O2/c16-7-9-2-1-3-11-13(9)22-12(19-11)6-10(18)14(21)20-15(8-17)4-5-15/h1-3,6H,4-5,18H2,(H,20,21) |
| InChIKey | OSLGYHFAXIMOFN-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 128.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-(7-cyano-1,3-benzoxazol-2-yl)-N-(1-cyanocyclopropyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(7-cyano-1,3-benzoxazol-2-yl)-N-(1-cyanocyclopropyl)prop-2-enamide?
The IUPAC name of 2-amino-3-(7-cyano-1,3-benzoxazol-2-yl)-N-(1-cyanocyclopropyl)prop-2-enamide (CID 174159519) is 2-amino-3-(7-cyano-1,3-benzoxazol-2-yl)-N-(1-cyanocyclopropyl)prop-2-enamide.
What is the SMILES notation for 2-amino-3-(7-cyano-1,3-benzoxazol-2-yl)-N-(1-cyanocyclopropyl)prop-2-enamide?
The canonical SMILES for 2-amino-3-(7-cyano-1,3-benzoxazol-2-yl)-N-(1-cyanocyclopropyl)prop-2-enamide is N#Cc1cccc2nc(C=C(N)C(=O)NC3(C#N)CC3)oc12.
What is the InChIKey of 2-amino-3-(7-cyano-1,3-benzoxazol-2-yl)-N-(1-cyanocyclopropyl)prop-2-enamide?
The InChIKey is OSLGYHFAXIMOFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N5O2/c16-7-9-2-1-3-11-13(9)22-12(19-11)6-10(18)14(21)20-15(8-17)4-5-15/h1-3,6H,4-5,18H2,(H,20,21).
What are the key properties of 2-amino-3-(7-cyano-1,3-benzoxazol-2-yl)-N-(1-cyanocyclopropyl)prop-2-enamide?
2-amino-3-(7-cyano-1,3-benzoxazol-2-yl)-N-(1-cyanocyclopropyl)prop-2-enamide has a molecular weight of 293.29 g/mol, XLogP of 1.17, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(7-cyano-1,3-benzoxazol-2-yl)-N-(1-cyanocyclopropyl)prop-2-enamide is sourced from PubChem (CID 174159519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).