About bis(2-propan-2-ylcyclopenta-1,3-dien-1-yl)tin
bis(2-propan-2-ylcyclopenta-1,3-dien-1-yl)tin (PubChem CID 174160021) has the molecular formula C16H22Sn
and a molecular weight of 333.06 g/mol. Its IUPAC name is bis(2-propan-2-ylcyclopenta-1,3-dien-1-yl)tin.
Molecular Properties
| Compound Name | bis(2-propan-2-ylcyclopenta-1,3-dien-1-yl)tin |
| PubChem CID | 174160021 |
| Molecular Formula | C16H22Sn |
| Molecular Weight | 333.06 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | bis(2-propan-2-ylcyclopenta-1,3-dien-1-yl)tin |
| SMILES | CC(C)C1=C([Sn]C2=C(C(C)C)C=CC2)CC=C1 |
| InChI | InChI=1S/2C8H11.Sn/c2*1-7(2)8-5-3-4-6-8;/h2*3,5,7H,4H2,1-2H3; |
| InChIKey | WOCRNEJRRVINAM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.06 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze bis(2-propan-2-ylcyclopenta-1,3-dien-1-yl)tin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-propan-2-ylcyclopenta-1,3-dien-1-yl)tin?
The IUPAC name of bis(2-propan-2-ylcyclopenta-1,3-dien-1-yl)tin (CID 174160021) is bis(2-propan-2-ylcyclopenta-1,3-dien-1-yl)tin.
What is the SMILES notation for bis(2-propan-2-ylcyclopenta-1,3-dien-1-yl)tin?
The canonical SMILES for bis(2-propan-2-ylcyclopenta-1,3-dien-1-yl)tin is CC(C)C1=C([Sn]C2=C(C(C)C)C=CC2)CC=C1.
What is the InChIKey of bis(2-propan-2-ylcyclopenta-1,3-dien-1-yl)tin?
The InChIKey is WOCRNEJRRVINAM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H11.Sn/c2*1-7(2)8-5-3-4-6-8;/h2*3,5,7H,4H2,1-2H3;.
What are the key properties of bis(2-propan-2-ylcyclopenta-1,3-dien-1-yl)tin?
bis(2-propan-2-ylcyclopenta-1,3-dien-1-yl)tin has a molecular weight of 333.06 g/mol, XLogP of 4.43, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-propan-2-ylcyclopenta-1,3-dien-1-yl)tin is sourced from PubChem (CID 174160021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).