C10H11N5O5 — CID 174160246
3,7-dihydropurine-2,6-dione;(2S)-5-oxopyrrolidine-2-carboxylic acid (PubChem CID 174160246) has the molecular formula C10H11N5O5 and a molecular weight of 281.23 g/mol. Its IUPAC name is 3,7-dihydropurine-2,6-dione;(2S)-5-oxopyrrolidine-2-carboxylic acid.
| Compound Name | 3,7-dihydropurine-2,6-dione;(2S)-5-oxopyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 174160246 |
| Molecular Formula | C10H11N5O5 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 3,7-dihydropurine-2,6-dione;(2S)-5-oxopyrrolidine-2-carboxylic acid |
| SMILES | O=C1CC[C@@H](C(=O)O)N1.O=c1[nH]c(=O)c2[nH]cnc2[nH]1 |
| InChI | InChI=1S/C5H4N4O2.C5H7NO3/c10-4-2-3(7-1-6-2)8-5(11)9-4;7-4-2-1-3(6-4)5(8)9/h1H,(H3,6,7,8,9,10,11);3H,1-2H2,(H,6,7)(H,8,9)/t;3-/m.0/s1 |
| InChIKey | FHSGGRGJDJDXIB-HVDRVSQOSA-N |
| XLogP | -1.71 |
| TPSA | 160.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |