C15H15F6N6OS+ — CID 174160274
[6-[4,6-bis[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-2-pyridinyl]methyl-oxosulfanium (PubChem CID 174160274) has the molecular formula C15H15F6N6OS+ and a molecular weight of 441.38 g/mol. Its IUPAC name is [6-[4,6-bis[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-2-pyridinyl]methyl-oxosulfanium.
| Compound Name | [6-[4,6-bis[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-2-pyridinyl]methyl-oxosulfanium |
|---|---|
| PubChem CID | 174160274 |
| Molecular Formula | C15H15F6N6OS+ |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | [6-[4,6-bis[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-2-pyridinyl]methyl-oxosulfanium |
| SMILES | C[C@@H](Nc1nc(N[C@H](C)C(F)(F)F)nc(-c2cccc(C[S+]=O)n2)n1)C(F)(F)F |
| InChI | InChI=1S/C15H15F6N6OS/c1-7(14(16,17)18)22-12-25-11(10-5-3-4-9(24-10)6-29-28)26-13(27-12)23-8(2)15(19,20)21/h3-5,7-8H,6H2,1-2H3,(H2,22,23,25,26,27)/q+1/t7-,8-/m1/s1 |
| InChIKey | WFDWNTWWBXQPRL-HTQZYQBOSA-N |
| XLogP | 3.59 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|