About (3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)oxyboronic acid
(3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)oxyboronic acid (PubChem CID 174160474) has the molecular formula C8H9BN2O3
and a molecular weight of 191.98 g/mol. Its IUPAC name is (3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)oxyboronic acid.
Molecular Properties
| Compound Name | (3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)oxyboronic acid |
| PubChem CID | 174160474 |
| Molecular Formula | C8H9BN2O3 |
| Molecular Weight | 191.98 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | (3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)oxyboronic acid |
| SMILES | Cc1c[nH]c2ncc(OB(O)O)cc12 |
| InChI | InChI=1S/C8H9BN2O3/c1-5-3-10-8-7(5)2-6(4-11-8)14-9(12)13/h2-4,12-13H,1H3,(H,10,11) |
| InChIKey | IMQRSHDPWHAEPZ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.98 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)oxyboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)oxyboronic acid?
The IUPAC name of (3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)oxyboronic acid (CID 174160474) is (3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)oxyboronic acid.
What is the SMILES notation for (3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)oxyboronic acid?
The canonical SMILES for (3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)oxyboronic acid is Cc1c[nH]c2ncc(OB(O)O)cc12.
What is the InChIKey of (3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)oxyboronic acid?
The InChIKey is IMQRSHDPWHAEPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BN2O3/c1-5-3-10-8-7(5)2-6(4-11-8)14-9(12)13/h2-4,12-13H,1H3,(H,10,11).
What are the key properties of (3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)oxyboronic acid?
(3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)oxyboronic acid has a molecular weight of 191.98 g/mol, XLogP of 0.22, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)oxyboronic acid is sourced from PubChem (CID 174160474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).